| Melting point |
-28°C |
| Boiling point |
224 °C0.3 mm Hg(lit.) |
| Density |
0.96 g/mL at 20 °C (lit.) |
| vapor density |
16.3 (vs air) |
| refractive index |
n20/D 1.497 |
| Flash point |
>230 °F |
| storage temp. |
2-8°C |
| solubility |
Practically insoluble in water, freely soluble in acetone, in anhydrous ethanol and in fatty oils. |
| form |
Viscous Liquid |
| Specific Gravity |
0.962 (20/4℃) |
| color |
Clear yellow viscous liquid |
| Odor |
Odorless |
| biological source |
synthetic (organic) |
| Water Solubility |
Immiscible with water. |
| Sensitive |
Air & Light Sensitive |
| Merck |
14,9495 |
| BRN |
97512 |
| Major Application |
pharmaceutical (small molecule) vitamins, nutraceuticals, and natural products |
| Cosmetics Ingredients Functions |
SKIN CONDITIONING ANTIOXIDANT |
| InChI |
1S/C31H52O3/c1-21(2)13-10-14-22(3)15-11-16-23(4)17-12-19-31(9)20-18-28-26(7)29(33-27(8)32)24(5)25(6)30(28)34-31/h21-23H,10-20H2,1-9H3/t22-,23-,31-/m1/s1 |
| InChIKey |
ZAKOWWREFLAJOT-CEFNRUSXSA-N |
| SMILES |
CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(OC(C)=O)c(C)c(C)c2O1 |
| LogP |
12.260 (est) |
| CAS DataBase Reference |
7695-91-2(CAS DataBase Reference) |
| NIST Chemistry Reference |
(+)-«ALPHA»-tocopherol acetate(7695-91-2) |
| EPA Substance Registry System |
2H-1-Benzopyran-6-ol, 3,4-dihydro-2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-, acetate (7695-91-2) |