| Melting point |
230-300℃ |
| Boiling point |
210 °C |
| Density |
1.3 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.475(lit.) |
| storage temp. |
2-8°C |
| solubility |
The solubility of cellulose acetate is greatly influenced by the level of acetyl groups present. In general, cellulose acetates are soluble in acetone–water blends of varying ratios, dichloromethane– ethanol blends, dimethyl formamide, and dioxane. |
| form |
Powder |
| Specific Gravity |
1.3 |
| color |
White |
| Odor |
at 100.00%. odorless |
| Thermal Conductivity |
0.167 W/(m·K) (low k); 0.335 W/(m·K) (high k) |
| Merck |
13,1978 |
| Dielectric constant |
3.2-7(0.0℃) |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions |
FILM FORMING |
| Cosmetic Ingredient Review (CIR) |
Cellulose acetate (9004-35-7) |
| InChIKey |
WOTQVEKSRLZRSX-OLIDUAMRSA-N |
| SMILES |
O1[C@H](C(C(C(C1COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)O[C@@H]2C(OC(C(C2OC(=O)C)OC(=O)C)OC(=O)C)COC(=O)C |
| EPA Substance Registry System |
Cellulose acetate (9004-35-7) |