| Melting point |
~25 °C(lit.) |
| alpha |
3 º (c=2, in ethanol 25 ºC) |
| Boiling point |
224 °C0.3 mm Hg(lit.) |
| Density |
0.953 g/mL at 25 °C(lit.) |
| refractive index |
n20/D 1.496(lit.) |
| Flash point |
>230 °F |
| storage temp. |
room temp |
| solubility |
Practically insoluble in water, freely soluble in acetone, in anhydrous ethanol and in fatty oils, soluble in ethanol (96 per cent). |
| form |
oil or semi-solid |
| color |
yellow |
| Odor |
cryst., odorless |
| biological source |
plant |
| Water Solubility |
<0.1 g/100 mL at 17 ºC |
| Merck |
14,9495 |
| Specific Activity |
~1360IU/g |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Cosmetics Ingredients Functions |
ANTIOXIDANT SKIN CONDITIONING |
| InChI |
1S/C31H52O3/c1-21(2)13-10-14-22(3)15-11-16-23(4)17-12-19-31(9)20-18-28-26(7)29(33-27(8)32)24(5)25(6)30(28)34-31/h21-23H,10-20H2,1-9H3/t22-,23-,31-/m1/s1 |
| InChIKey |
ZAKOWWREFLAJOT-CEFNRUSXSA-N |
| SMILES |
CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCc2c(C)c(OC(C)=O)c(C)c(C)c2O1 |
| LogP |
12.260 (est) |
| CAS DataBase Reference |
58-95-7(CAS DataBase Reference) |
| NIST Chemistry Reference |
Vitamin e acetate(58-95-7) |
| EPA Substance Registry System |
D-.alpha.-Tocopheryl acetate (58-95-7) |