| Melting point |
196-198 °C (dec.)(lit.) |
| Boiling point |
285.62°C (rough estimate) |
| Density |
1.439 (estimate) |
| refractive index |
1.5220 (estimate) |
| storage temp. |
-20°C |
| solubility |
DMSO (Sparingly), Methanol (Slightly, Heated) |
| pka |
pK1:2.71;pK2:3.48;pK3:8.89(SH);pK4:10.79(SH) (25°C) |
| form |
Powder |
| color |
White to off-white |
| Water Solubility |
Soluble in water, and ethanol (25 mg/ml, results in colorless to light yellow, clear). |
| Merck |
14,8865 |
| BRN |
1725150 |
| Stability |
Stable. Combustible. Incompatible with strong oxidizing agents. |
| InChI |
1S/C4H6O4S2/c5-3(6)1(9)2(10)4(7)8/h1-2,9-10H,(H,5,6)(H,7,8)/t1-,2+ |
| InChIKey |
ACTRVOBWPAIOHC-XIXRPRMCSA-N |
| SMILES |
OC(=O)[C@@H](S)[C@@H](S)C(O)=O |
| CAS DataBase Reference |
304-55-2(CAS DataBase Reference) |
| EPA Substance Registry System |
Butanedioic acid, 2,3-dimercapto-, (2R,3S)-rel- (304-55-2) |
