| Melting point |
153-159 °C (lit.) |
| Boiling point |
310 °C (decomp) |
| bulk density |
560kg/m3 |
| Density |
1.67 g/cm3 at 20 °C |
| vapor density |
7.26 (vs air) |
| vapor pressure |
<0.1 hPa (20 °C) |
| refractive index |
1.493~1.509 |
| FEMA |
2306 | CITRIC ACID |
| Flash point |
100 °C |
| storage temp. |
2-8°C |
| solubility |
Citric acid also dissolves in absolute (anhydrous) ethanol (76 parts of citric acid per 100 parts of ethanol) at 15 °C. |
| form |
grit |
| pka |
3.14(at 20℃) |
| color |
White |
| Odor |
Odorless |
| PH |
3.24(1 mM solution);2.62(10 mM solution);2.08(100 mM solution); |
| Odor Type |
odorless |
| biological source |
synthetic |
| explosive limit |
8%, 65°F |
| Water Solubility |
soluble in Water (1174g/L at 10°C, 1809g/L at 30°C, 3825g/L at 80°C). |
| Sensitive |
Hygroscopic |
| λmax |
λ: 260 nm Amax: 0.20
λ: 280 nm Amax: 0.10 |
| Merck |
14,2326 |
| JECFA Number |
218 |
| BRN |
782061 |
| Stability |
Stable. Incompatible with bases, strong oxidizing agents, reducing agents, metal nitrates. |
| Cosmetics Ingredients Functions |
CHELATING
FRAGRANCE
BUFFERING |
| Cosmetic Ingredient Review (CIR) |
Citric acid (77-92-9) |
| InChI |
1S/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey |
KRKNYBCHXYNGOX-UHFFFAOYSA-N |
| SMILES |
OC(=O)CC(O)(CC(O)=O)C(O)=O |
| LogP |
-1.64 |
| CAS DataBase Reference |
77-92-9(CAS DataBase Reference) |
| NIST Chemistry Reference |
1,2,3-Propanetricarboxylic acid, 2-hydroxy-(77-92-9) |
| EPA Substance Registry System |
Citric acid (77-92-9) |
