| Melting point |
236-238 °C(lit.) |
| alpha |
169 º (c=0.5, dioxane) |
| Boiling point |
410.86°C (rough estimate) |
| Density |
1.1121 (rough estimate) |
| refractive index |
170 ° (C=0.5, Dioxane) |
| Flash point |
>200℃ |
| storage temp. |
2-8°C |
| solubility |
Practically insoluble in water, slightly soluble in ethanol (96 per cent) and in methylene chloride. It shows polymorphism (5.9). |
| form |
Solid |
| pka |
12.36±0.60(Predicted) |
| color |
White to Off-White |
| Water Solubility |
115mg/L(25 ºC) |
| Merck |
7722 |
| BRN |
2065301 |
| Henry's Law Constant |
3.5×104 mol/(m3Pa) at 25℃, HSDB (2015) |
| BCS Class |
1 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
clinical testing |
| InChIKey |
XOFYZVNMUHMLCC-ZPOLXVRWSA-N |
| SMILES |
O[C@]1([C@@]2([C@H]([C@H]3[C@@H]([C@@]4(C(=CC(=O)C=C4)CC3)C)C(=O)C2)CC1)C)C(=O)CO |
| CAS DataBase Reference |
53-03-2(CAS DataBase Reference) |
| IARC |
3 (Vol. 26, Sup 7) 1987 |
| NIST Chemistry Reference |
Prednisone(53-03-2) |
| EPA Substance Registry System |
Prednisone (53-03-2) |
