| Melting point |
240 °C (dec.) (lit.) |
| alpha |
D25 +102° (dioxane) |
| Boiling point |
412.46°C (rough estimate) |
| Density |
1.0963 (rough estimate) |
| refractive index |
100 ° (C=1, Dioxane) |
| Flash point |
2℃ |
| storage temp. |
2-8°C |
| solubility |
Very slightly soluble in water, soluble in ethanol (96 per cent) and in methanol, sparingly soluble in acetone, slightly soluble in methylene chloride. It shows polymorphism (5.9). |
| pka |
12.46±0.70(Predicted) |
| form |
powder |
| color |
White to Off-White |
| Water Solubility |
2.225g/L(25 ºC) |
| Merck |
14,7721 |
| BRN |
1354103 |
| BCS Class |
1 |
| Major Application |
clinical testing |
| InChIKey |
OIGNJSKKLXVSLS-VWUMJDOOSA-N |
| SMILES |
O[C@]1([C@@]2([C@H]([C@H]3[C@@H]([C@@]4(C(=CC(=O)C=C4)CC3)C)[C@H](C2)O)CC1)C)C(=O)CO |
| CAS DataBase Reference |
50-24-8(CAS DataBase Reference) |
| EPA Substance Registry System |
Prednisolone (50-24-8) |
