| Melting point |
240-244 °C |
| alpha |
D25 +116° (dioxane) |
| Boiling point |
579.8±50.0 °C(Predicted) |
| Density |
1.28±0.1 g/cm3(Predicted) |
| refractive index |
112 ° (C=1, Dioxane) |
| storage temp. |
2-8°C |
| solubility |
Practically insoluble in water, slightly soluble in ethanol (96 per cent) and in methylene chloride. |
| form |
Solid |
| pka |
12.41±0.70(Predicted) |
| color |
White to Off-White |
| Water Solubility |
11.6mg/L(25 ºC) |
| Merck |
7721 |
| BRN |
3111798 |
| Stability |
Stable. Incompatible with strong oxidizing agents. |
| Major Application |
pharmaceutical (small molecule) |
| InChIKey |
LRJOMUJRLNCICJ-JZYPGELDSA-N |
| SMILES |
[H][C@@]12CCC3=CC(=O)C=C[C@]3(C)[C@@]1([H])[C@@H](O)C[C@@]4(C)[C@@]2([H])CC[C@]4(O)C(=O)COC(C)=O |
| CAS DataBase Reference |
52-21-1(CAS DataBase Reference) |
| NIST Chemistry Reference |
1,4-Pregnadiene-3,20-dione, 11beta,17alpha,21-trihydroxy-, acetate(52-21-1) |