| Melting point |
broad (160?C transition) |
| Boiling point |
840.9±65.0 °C(Predicted) |
| Density |
2.173±0.06 g/cm3(Predicted) |
| storage temp. |
Keep in dark place,Sealed in dry,2-8°C |
| solubility |
Freely soluble in water and in dimethyl sulfoxide, practically insoluble in ethanol (96 per cent) and in acetone. |
| form |
Solid |
| pka |
10.62±0.70(Predicted) |
| color |
White to off-white |
| Stability |
Hygroscopic |
| Major Application |
clinical |
| InChI |
InChI=1S/C18H24I3N3O8/c1-24(4-9(28)6-26)18(31)12-13(19)11(17(30)22-3-8(27)5-25)14(20)16(15(12)21)23-10(29)7-32-2/h8-9,25-28H,3-7H2,1-2H3,(H,22,30)(H,23,29) |
| InChIKey |
DGAIEPBNLOQYER-UHFFFAOYSA-N |
| SMILES |
C1(C(N(CC(O)CO)C)=O)=C(I)C(NC(COC)=O)=C(I)C(C(NCC(O)CO)=O)=C1I |
| CAS DataBase Reference |
73334-07-3(CAS DataBase Reference) |
| EPA Substance Registry System |
1,3-Benzenedicarboxamide, N1,N3-bis(2,3-dihydroxypropyl)-2,4,6-triiodo-5-[(2-methoxyacetyl)amino]-N1-methyl- (73334-07-3) |