Tetrabutylammonium cyanide
- Product NameTetrabutylammonium cyanide
- CAS10442-39-4
- MFC17H36N2
- MW268.48
- EINECS233-926-0
- MOL File10442-39-4.mol
Chemical Properties
| Melting point | 89-92 °C(lit.) |
| storage temp. | Storage temp. 2-8°C |
| solubility | Methanol (Slightly), Water (Slightly) |
| form | Solid |
| color | Pale Yellow to Pale Beige |
| BRN | 3598808 |
| Stability | Hygroscopic |
| InChI | InChI=1S/C16H36N.CN/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-2/h5-16H2,1-4H3;/q+1;-1 |
| InChIKey | KRRBFUJMQBDDPR-UHFFFAOYSA-N |
| SMILES | [N+](CCCC)(CCCC)(CCCC)CCCC.N#[C-] |
| EPA Substance Registry System | 1-Butanaminium, N,N,N-tributyl-, cyanide (10442-39-4) |
Safety Information
| Hazard Codes | T+,N |
| Risk Statements | 26/27/28-32-50/53 |
| Safety Statements | 7-28-29-45-60-61 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| F | 3-10 |
| TSCA | TSCA listed |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 1 Dermal Acute Tox. 2 Inhalation Acute Tox. 2 Oral Aquatic Acute 1 Aquatic Chronic 1 |