Borane tert-butylamine complex
- Product NameBorane tert-butylamine complex
- CAS7337-45-3
- MFC4H11BN
- MW86.97
- EINECS230-851-5
- MOL File7337-45-3.mol
Chemical Properties
| Melting point | 98-100 °C (dec.)(lit.) |
| Density | 0,87 g/cm3 |
| storage temp. | Refrigerator |
| solubility | 27g/l |
| form | powder |
| color | White to off-white |
| Water Solubility | Soluble in water (27 g/L at 20°C) and methanol. |
| BRN | 4134905 |
| InChI | InChI=1S/C4H11N.BH3/c1-4(2,3)5;/h5H2,1-3H3;1H3 |
| InChIKey | GKFJEDWZQZKYHV-UHFFFAOYSA-N |
| SMILES | N([H])([H])C(C([H])([H])[H])(C([H])([H])[H])C([H])([H])[H].B |
| EPA Substance Registry System | Boron, trihydro(2-methyl-2-propanamine)-, (T-4)- (7337-45-3) |
Safety Information
| Hazard Codes | T |
| Risk Statements | 21-25-36/37/38 |
| Safety Statements | 26-36/37-45 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | EO3900000 |
| F | 9 |
| TSCA | TSCA listed |
| HazardClass | 4.1 |
| PackingGroup | III |
| HS Code | 29299090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Oral Aquatic Chronic 2 Eye Irrit. 2 Skin Irrit. 2 |
