4-Acetamido-2,2,6,6-tetramethyl-1-oxopiperidinium tetrafluoroborate,95.0+%(T)
- Product Name4-Acetamido-2,2,6,6-tetramethyl-1-oxopiperidinium tetrafluoroborate,95.0+%(T)
- CAS219543-09-6
- MFC11H21BF4N2O2
- MW0
- EINECS
- MOL File219543-09-6.mol
Chemical Properties
| Melting point | 191-197°C (decomposition) |
| storage temp. | 2-8°C |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| InChI | 1S/C11H20N2O2.BF4/c1-8(14)12-9-6-10(2,3)13(15)11(4,5)7-9;2-1(3,4)5/h9H,6-7H2,1-5H3;/q;-1/p+1 |
| InChIKey | HTMHEICBCHCWAU-UHFFFAOYSA-O |
| SMILES | F[B-](F)(F)F.CC(=O)NC1CC(C)(C)[N+](=O)C(C)(C)C1 |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26 |
| RIDADR | UN 1759 8/PG III |
| WGK Germany | 3 |
| HS Code | 2933.39.9200 |
| HazardClass | 8 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
