4-Chlorobiphenyl
- Product Name4-Chlorobiphenyl
- CAS2051-62-9
- MFC12H9Cl
- MW188.65
- EINECS218-127-7
- MOL File2051-62-9.mol
Chemical Properties
| Melting point | 32 °C(lit.) |
| Boiling point | 130°C/1mm |
| Density | 1.1320 (estimate) |
| refractive index | 1.5830 (estimate) |
| storage temp. | Refrigerator |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Water Solubility | <0.1 g/100 mL at 22 ºC |
| Henry's Law Constant | 2.8×10-2 mol/(m3Pa) at 25℃, Li et al. (2003) |
| Major Application | environmental |
| InChI | InChI=1S/C12H9Cl/c13-12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H |
| InChIKey | FPWNLURCHDRMHC-UHFFFAOYSA-N |
| SMILES | C1(C2=CC=CC=C2)=CC=C(Cl)C=C1 |
| CAS DataBase Reference | 2051-62-9(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,1'-Biphenyl, 4-chloro-(2051-62-9) |
| EPA Substance Registry System | 4-Chlorobiphenyl (2051-62-9) |
Safety Information
| Hazard Codes | N,Xi |
| Risk Statements | 33-50/53-36/37/38 |
| Safety Statements | 35-60-61-36-26 |
| RIDADR | UN 3432 9/PG 2 |
| WGK Germany | 3 |
| RTECS | DV2080000 |
| Hazard Note | Irritant |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 2903998090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
| Toxicity | mammal (species unspecified),LDLo,oral,3500mg/kg (3500mg/kg),Journal of Industrial Hygiene. Vol. 13, Pg. 87, 1931. |
