2,5-Dimethoxybenzoic acid
- Product Name2,5-Dimethoxybenzoic acid
- CAS2785-98-0
- MFC9H10O4
- MW182.17
- EINECS220-503-0
- MOL File2785-98-0.mol
Chemical Properties
| Melting point | 76-78 °C (lit.) |
| Boiling point | 275.56°C (rough estimate) |
| Density | 1.2481 (rough estimate) |
| refractive index | 1.4500 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| pka | 3.97±0.10(Predicted) |
| form | powder to crystal |
| color | White to Almost white |
| BRN | 2097993 |
| InChI | InChI=1S/C9H10O4/c1-12-6-3-4-8(13-2)7(5-6)9(10)11/h3-5H,1-2H3,(H,10,11) |
| InChIKey | NYJBTJMNTNCTCP-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(OC)=CC=C1OC |
| LogP | 1.281 (est) |
| CAS DataBase Reference | 2785-98-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzoic acid, 2,5-dimethoxy-(2785-98-0) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 37/39-26-36/37-36 |
| WGK Germany | 3 |
| HS Code | 29189900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
