2,5-Dimethoxy-3-nitrobenzoic acid
- Product Name2,5-Dimethoxy-3-nitrobenzoic acid
- CAS17894-26-7
- MFC9H9NO6
- MW227.17
- EINECS
- MOL File17894-26-7.mol
Chemical Properties
| Melting point | 183-187 °C (lit.) |
| Boiling point | 368.87°C (rough estimate) |
| Density | 1.4777 (rough estimate) |
| refractive index | 1.5800 (estimate) |
| solubility | soluble in Methanol |
| form | powder to crystal |
| color | Light yellow to Yellow to Orange |
| InChI | 1S/C9H9NO6/c1-15-5-3-6(9(11)12)8(16-2)7(4-5)10(13)14/h3-4H,1-2H3,(H,11,12) |
| InChIKey | QCJROOYLFVYZEP-UHFFFAOYSA-N |
| SMILES | COc1cc(C(O)=O)c(OC)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 17894-26-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HS Code | 29189900 |
| Storage Class | 13 - Non Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |