4-Methoxy-2-nitrophenol
- Product Name4-Methoxy-2-nitrophenol
- CAS1568-70-3
- MFC7H7NO4
- MW169.13
- EINECS
- MOL File1568-70-3.mol
Chemical Properties
| Melting point | 78-80 °C (lit.) |
| Boiling point | 298.4°C (rough estimate) |
| Density | 1.3375 (estimate) |
| refractive index | 1.5830 (rough estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | Soluble in methanol almost transparency. |
| pka | 7.33±0.14(Predicted) |
| form | powder to crystal |
| color | Light yellow to Brown |
| Henry's Law Constant | 5.3×100 mol/(m3Pa) at 25℃, Tremp et al. (1993) |
| InChI | 1S/C7H7NO4/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4,9H,1H3 |
| InChIKey | YBUGOACXDPDUIR-UHFFFAOYSA-N |
| SMILES | COc1ccc(O)c(c1)[N+]([O-])=O |
| CAS DataBase Reference | 1568-70-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Phenol, 4-methoxy-2-nitro-(1568-70-3) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39-24/25 |
| WGK Germany | 3 |
| HS Code | 29095000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
