3,4,5-Trichloroaniline
- Product Name3,4,5-Trichloroaniline
- CAS634-91-3
- MFC6H4Cl3N
- MW196.46
- EINECS211-218-2
- MOL File634-91-3.mol
Chemical Properties
| Melting point | 97-99 °C (lit.) |
| Boiling point | 321.87°C (rough estimate) |
| Density | 1.540 |
| refractive index | 1.5596 (estimate) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| form | powder to crystal |
| pka | 1.85±0.10(Predicted) |
| color | White to Light yellow |
| Water Solubility | Insoluble in water. |
| BRN | 638880 |
| InChI | InChI=1S/C6H4Cl3N/c7-4-1-3(10)2-5(8)6(4)9/h1-2H,10H2 |
| InChIKey | XOGYQVITULCUGU-UHFFFAOYSA-N |
| SMILES | C1(N)=CC(Cl)=C(Cl)C(Cl)=C1 |
| CAS DataBase Reference | 634-91-3(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,N |
| Risk Statements | 23/24/25-33-50/53 |
| Safety Statements | 28-36/37-45-60-61 |
| RIDADR | UN 2811 6.1/PG 2 |
| WGK Germany | 3 |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29214200 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |