Pentachloroaniline
- Product NamePentachloroaniline
- CAS527-20-8
- MFC6H2Cl5N
- MW265.35
- EINECS208-410-3
- MOL File527-20-8.mol
Chemical Properties
| Melting point | 232 °C |
| Boiling point | 335.8±37.0 °C(Predicted) |
| Density | 1.751±0.06 g/cm3(Predicted) |
| Flash point | 100 °C |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly, Heated), DMSO (Slightly), Methanol (Slightly, Heated) |
| pka | -2.04±0.10(Predicted) |
| color | White to Light yellow to Light orange |
| Sensitive | Air & Light Sensitive |
| BRN | 2806732 |
| Henry's Law Constant | 2.3×101 mol/(m3Pa) at 25℃, HSDB (2015) |
| Stability | Hygroscopic |
| Major Application | agriculture environmental |
| InChI | 1S/C6H2Cl5N/c7-1-2(8)4(10)6(12)5(11)3(1)9/h12H2 |
| InChIKey | KHCZSJXTDDHLGJ-UHFFFAOYSA-N |
| SMILES | Nc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| CAS DataBase Reference | 527-20-8(CAS DataBase Reference) |
| NIST Chemistry Reference | Pentachloroaniline(527-20-8) |
Safety Information
| Hazard Codes | T,N |
| Risk Statements | 20/21/22-36/37/38-23/24/25-33-50/53 |
| Safety Statements | 26-36/37/39-45-22-36/37-61-60-28 |
| RIDADR | 2811 |
| WGK Germany | 3 |
| RTECS | BY7910000 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29214200 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Dermal Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
| Hazardous Substances Data | 527-20-8(Hazardous Substances Data) |
