2,3-Dimethylhydroquinone
- Product Name2,3-Dimethylhydroquinone
- CAS608-43-5
- MFC8H10O2
- MW138.16
- EINECS
- MOL File608-43-5.mol
Chemical Properties
| Melting point | 223-225 °C (lit.) |
| Boiling point | 193.57°C (rough estimate) |
| Density | 1.0340 (rough estimate) |
| refractive index | 1.4698 (estimate) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Powder |
| pka | 10.85±0.23(Predicted) |
| color | White to off-white |
| Water Solubility | Slightly soluble in water |
| BRN | 636976 |
| Stability | Stable. Incompatible with strong oxidizing agents. |
| InChI | InChI=1S/C8H10O2/c1-5-6(2)8(10)4-3-7(5)9/h3-4,9-10H,1-2H3 |
| InChIKey | BXJGUBZTZWCMEX-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(O)C(C)=C1C |
| CAS DataBase Reference | 608-43-5(CAS DataBase Reference) |
| NIST Chemistry Reference | 2,3-Dimethylhydroquinone(608-43-5) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| F | 8-9-23 |
| HS Code | 2907299090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
