Methyl furan-3-carboxylate
- Product NameMethyl furan-3-carboxylate
- CAS13129-23-2
- MFC6H6O3
- MW126.11
- EINECS215-614-6
- MOL File13129-23-2.mol
Chemical Properties
| Melting point | 64-67 °C |
| Boiling point | 64°C/4mmHg |
| Density | 1.17 |
| refractive index | 1.4670 to 1.4700 |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| InChI | InChI=1S/C6H6O3/c1-8-6(7)5-2-3-9-4-5/h2-4H,1H3 |
| InChIKey | ZKHQSQYLKSSYIP-UHFFFAOYSA-N |
| SMILES | O1C=CC(C(OC)=O)=C1 |
| CAS DataBase Reference | 13129-23-2(CAS DataBase Reference) |
| NIST Chemistry Reference | 3-Furancarboxylic acid, methyl ester(13129-23-2) |
