Diethylphenylphosphine
- Product NameDiethylphenylphosphine
- CAS1605-53-4
- MFC10H15P
- MW166.2
- EINECS216-516-6
- MOL File1605-53-4.mol
Chemical Properties
| Melting point | 45 °C |
| Boiling point | 120-121 °C/29 mmHg (lit.) |
| Density | 0.954 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 185 °F |
| form | Liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 0.954 |
| Water Solubility | Not miscible or difficult to mix in water. |
| Sensitive | Air & Moisture Sensitive |
| BRN | 742484 |
| InChI | InChI=1S/C10H15P/c1-3-11(4-2)10-8-6-5-7-9-10/h5-9H,3-4H2,1-2H3 |
| InChIKey | LVTCZSBUROAWTE-UHFFFAOYSA-N |
| SMILES | P(CC)(CC)C1=CC=CC=C1 |
| CAS DataBase Reference | 1605-53-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 17-26-36 |
| RIDADR | UN3278 |
| WGK Germany | 3 |
| F | 10 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
