2-Acetylbenzoic acid
- Product Name2-Acetylbenzoic acid
- CAS577-56-0
- MFC9H8O3
- MW164.16
- EINECS209-413-2
- MOL File577-56-0.mol
Chemical Properties
| Melting point | 115-117 °C (lit.) |
| Boiling point | 251.61°C (rough estimate) |
| Density | 1.2132 (rough estimate) |
| refractive index | 1.5380 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Dichloromethane, Ethyl Acetate, Methanol (Slightly) |
| form | Crystalline Powder |
| pka | pK1: 4.13 (25°C) |
| color | Light yellow to light orange |
| Water Solubility | Soluble in Dichloromethane and Ethyl Acetate. Slightly soluble in water. |
| BRN | 1210557 |
| InChI | InChI=1S/C9H8O3/c1-6(10)7-4-2-3-5-8(7)9(11)12/h2-5H,1H3,(H,11,12) |
| InChIKey | QDAWXRKTSATEOP-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC=CC=C1C(C)=O |
| CAS DataBase Reference | 577-56-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Acetylbenzoic acid(577-56-0) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 37/39-26-36-24/25 |
| WGK Germany | 3 |
| HS Code | 29183000 |
| Storage Class | 11 - Combustible Solids |
