Benzyl acrylate
- Product NameBenzyl acrylate
- CAS2495-35-4
- MFC10H10O2
- MW162.19
- EINECS219-673-9
- MOL File2495-35-4.mol
Chemical Properties
| Melting point | 214-216 °C |
| Boiling point | 110-111°C 8mm |
| Density | 1,08 g/cm3 |
| vapor pressure | 11.2Pa at 25℃ |
| refractive index | 1.5180 |
| Flash point | 111°C/8mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Colorless |
| Water Solubility | Miscible with organic solvents and water. |
| InChI | InChI=1S/C10H10O2/c1-2-10(11)12-8-9-6-4-3-5-7-9/h2-7H,1,8H2 |
| InChIKey | GCTPMLUUWLLESL-UHFFFAOYSA-N |
| SMILES | C(OCC1=CC=CC=C1)(=O)C=C |
| LogP | 2.436 |
| CAS DataBase Reference | 2495-35-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzyl acrylate (2495-35-4) |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39-61-28 |
| RIDADR | UN3082 |
| WGK Germany | WGK 3 |
| TSCA | TSCA listed |
| HazardClass | 9 |
| PackingGroup | III |
| HS Code | 29161290 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Aquatic Chronic 2 Skin Irrit. 2 STOT SE 3 |
