Benzyl acrylate
- Product NameBenzyl acrylate
- CAS2495-35-4
- CBNumberCB9349979
- MFC10H10O2
- MW162.19
- EINECS219-673-9
- MDL NumberMFCD00048147
- MOL File2495-35-4.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 214-216 °C |
| Boiling point | 110-111°C 8mm |
| Density | 1,08 g/cm3 |
| vapor pressure | 11.2Pa at 25℃ |
| refractive index | 1.5180 |
| Flash point | 111°C/8mm |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethyl Acetate (Slightly) |
| form | Liquid |
| color | Colorless |
| Water Solubility | Miscible with organic solvents and water. |
| InChI | InChI=1S/C10H10O2/c1-2-10(11)12-8-9-6-4-3-5-7-9/h2-7H,1,8H2 |
| InChIKey | GCTPMLUUWLLESL-UHFFFAOYSA-N |
| SMILES | C(OCC1=CC=CC=C1)(=O)C=C |
| LogP | 2.436 |
| CAS DataBase Reference | 2495-35-4(CAS DataBase Reference) |
| EPA Substance Registry System | Benzyl acrylate (2495-35-4) |
| UNSPSC Code | 12352005 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Warning | |||||||||
| Hazard statements | H315-H335-H411 | |||||||||
| Precautionary statements | P261-P264-P271-P273-P280-P302+P352 | |||||||||
| Risk Statements | 36/37/38 | |||||||||
| Safety Statements | 26-36/37/39-61-28 | |||||||||
| RIDADR | UN3082 | |||||||||
| TSCA | Yes | |||||||||
| HazardClass | 9 | |||||||||
| PackingGroup | III | |||||||||
| HS Code | 29161290 | |||||||||
| NFPA 704: |
|
