Sarsasapogenin
- Product NameSarsasapogenin
- CAS126-19-2
- MFC27H44O3
- MW416.64
- EINECS204-776-3
- MOL File126-19-2.mol
Chemical Properties
| Melting point | 194°C |
| alpha | D25 -75°; 25546 -89° (c = 0.5 in CHCl3) |
| Boiling point | 474.91°C (rough estimate) |
| Density | 1.0362 (rough estimate) |
| refractive index | 1.4700 (estimate) |
| storage temp. | 2-8°C |
| solubility | DMF: 2 mg/ml; DMSO: 0.2 mg/ml; Ethanol: 2 mg/ml; Ethanol:PBS (pH 7.2)(1:2): 0.3 mg/ml |
| form | A crystalline solid |
| pka | 15.14±0.70(Predicted) |
| color | White to off-white |
| optical activity | -7525 (c 0.5, CHCl3) |
| Merck | 13,8456 |
| Major Application | metabolomics vitamins, nutraceuticals, and natural products |
| Cosmetics Ingredients Functions | SKIN CONDITIONING |
| InChIKey | GMBQZIIUCVWOCD-WWASVFFGSA-N |
| SMILES | C[C@H]1CC[C@@]2(OC1)O[C@H]3C[C@H]4[C@@H]5CC[C@@H]6C[C@@H](O)CC[C@]6(C)[C@H]5CC[C@]4(C)[C@H]3[C@@H]2C |
| LogP | 6.210 (est) |
| CAS DataBase Reference | 126-19-2(CAS DataBase Reference) |