| Melting point |
43-46 °C(lit.) |
| Boiling point |
260 °C712 mm Hg(lit.) |
| Density |
1.2511 (rough estimate) |
| refractive index |
1.4300 (estimate) |
| Flash point |
>230 °F |
| storage temp. |
Inert atmosphere,Room Temperature |
| solubility |
Soluble in Chloroform,Dichloromethane,Ethyl Acetate,DMSO,Acetone,etc. |
| pka |
14.75±0.46(Predicted) |
| form |
powder to lump |
| color |
White to Almost white |
| Major Application |
peptide synthesis |
| InChI |
InChI=1S/C6H11NO3/c1-3-10-6(9)4-7-5(2)8/h3-4H2,1-2H3,(H,7,8) |
| InChIKey |
AMBDTBHJFINMSE-UHFFFAOYSA-N |
| SMILES |
C(OCC)(=O)CNC(C)=O |
| CAS DataBase Reference |
1906-82-7(CAS DataBase Reference) |
| NIST Chemistry Reference |
Glycine, N-acetyl-, ethyl ester(1906-82-7) |
