N-Benzylglycine ethyl ester
- Product NameN-Benzylglycine ethyl ester
- CAS6436-90-4
- MFC11H15NO2
- MW193.24
- EINECS229-218-6
- MOL File6436-90-4.mol
Chemical Properties
| Boiling point | 140-142 °C/10 mmHg (lit.) |
| Density | 1.031 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | 2-8°C |
| form | Liquid |
| pka | 6.84±0.20(Predicted) |
| color | Clear colorless to light yellow |
| Water Solubility | Not miscible or difficult to mix in water. |
| BRN | 2104816 |
| InChI | InChI=1S/C11H15NO2/c1-2-14-11(13)9-12-8-10-6-4-3-5-7-10/h3-7,12H,2,8-9H2,1H3 |
| InChIKey | ULOLIZHBYWAICY-UHFFFAOYSA-N |
| SMILES | C(OCC)(=O)CNCC1=CC=CC=C1 |
| CAS DataBase Reference | 6436-90-4(CAS DataBase Reference) |
| NIST Chemistry Reference | N-Benzylglycine ethyl ester(6436-90-4) |
Safety Information
| Hazard Codes | C,Xi,Xn |
| Risk Statements | 34-36/37/38-20/21/22 |
| Safety Statements | 23-24/25-45-36/37/39-26-36 |
| RIDADR | UN2735 |
| WGK Germany | 3 |
| HS Code | 29224999 |
