| Melting point |
159-160 °C |
| Boiling point |
55 °C/12 mmHg (lit.) |
| Density |
1.27 g/mL at 25 °C (lit.) |
| refractive index |
n20/D 1.428(lit.) |
| Flash point |
160 °F |
| storage temp. |
Inert atmosphere,Room Temperature |
| form |
Liquid |
| Specific Gravity |
1.270 |
| color |
Clear colorless to pale yellow |
| Water Solubility |
Reacts with water violently. |
| Sensitive |
Moisture Sensitive |
| InChI |
InChI=1S/C4H5ClO3/c1-3(6)8-2-4(5)7/h2H2,1H3 |
| InChIKey |
HZDNNJABYXNPPV-UHFFFAOYSA-N |
| SMILES |
C(Cl)(COC(C)=O)=O |
| CAS DataBase Reference |
13831-31-7(CAS DataBase Reference) |
