Acetoxyacetyl chloride
- Product NameAcetoxyacetyl chloride
- CAS13831-31-7
- CBNumberCB9235489
- MFC4H5ClO3
- MW136.53
- EINECS237-542-4
- MDL NumberMFCD00011535
- MOL File13831-31-7.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 159-160 °C |
| Boiling point | 55 °C/12 mmHg (lit.) |
| Density | 1.27 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 160 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | Liquid |
| Specific Gravity | 1.270 |
| color | Clear colorless to pale yellow |
| Water Solubility | Reacts with water violently. |
| Sensitive | Moisture Sensitive |
| InChI | InChI=1S/C4H5ClO3/c1-3(6)8-2-4(5)7/h2H2,1H3 |
| InChIKey | HZDNNJABYXNPPV-UHFFFAOYSA-N |
| SMILES | C(Cl)(COC(C)=O)=O |
| CAS DataBase Reference | 13831-31-7(CAS DataBase Reference) |
| FDA UNII | Z4S19Y2F8S |
| UNSPSC Code | 12352100 |
| NACRES | NA.22 |
Safety
| Symbol(GHS) |
 
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H314-H335 | |||||||||
| Precautionary statements | P261-P271-P280-P303+P361+P353-P304+P340+P310-P305+P351+P338 | |||||||||
| Hazard Codes | C | |||||||||
| Risk Statements | 14-34-36/37 | |||||||||
| Safety Statements | 23-26-27-36/37/39-45-8 | |||||||||
| RIDADR | UN 3265 8/PG 2 | |||||||||
| WGK Germany | 3 | |||||||||
| Hazard Note | Corrosive | |||||||||
| TSCA | N | |||||||||
| HazardClass | 8 | |||||||||
| PackingGroup | II | |||||||||
| HS Code | 29183000 | |||||||||
| Storage Class | 8A - Combustible corrosive hazardous materials | |||||||||
| Hazard Classifications | Skin Corr. 1B STOT SE 3 | |||||||||
| NFPA 704: |
|
