Diphenyl diselenide
- Product NameDiphenyl diselenide
- CAS1666-13-3
- MFC12H10Se2
- MW312.13
- EINECS216-780-2
- MOL File1666-13-3.mol
Chemical Properties
| Melting point | 60 °C |
| Boiling point | 202 °C / 11mmHg |
| Density | 1.5570 |
| refractive index | 1.7430 |
| storage temp. | Store below +30°C. |
| form | Powder |
| color | yellow |
| Specific Gravity | 1.84 |
| Water Solubility | Insoluble |
| Hydrolytic Sensitivity | 8: reacts rapidly with moisture, water, protic solvents |
| BRN | 2047179 |
| Exposure limits | ACGIH: TWA 0.2 mg/m3 NIOSH: IDLH 1 mg/m3; TWA 0.2 mg/m3 |
| InChI | 1S/C12H10Se2/c1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12/h1-10H |
| InChIKey | YWWZCHLUQSHMCL-UHFFFAOYSA-N |
| SMILES | [Se]([Se]c1ccccc1)c2ccccc2 |
| CAS DataBase Reference | 1666-13-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Diselenide, diphenyl(1666-13-3) |
| EPA Substance Registry System | Diselenide, diphenyl (1666-13-3) |
Safety Information
| Hazard Codes | T,N |
| Risk Statements | 23/25-33-50/53 |
| Safety Statements | 20/21-28-45-60-61-28A |
| RIDADR | UN 3283 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | JM9152500 |
| TSCA | TSCA listed |
| HS Code | 2931 90 00 |
| HazardClass | 6.1 |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 3 Inhalation Acute Tox. 3 Oral Aquatic Acute 1 Aquatic Chronic 1 STOT RE 2 |
