| Melting point |
140-144 °C(lit.) |
| storage temp. |
Keep in dark place,Inert atmosphere,Room temperature |
| solubility |
Soluble in tetrahydrofuran, ethyl acetate, methanol, acetonitrile, dimethylformamide, dimethyl carbonate. Sparingly soluble in chloroform and dichloromethane. Insoluble in pentanes, hexanes, toluene and diethyl ether. |
| form |
Crystalline |
| color |
White to Almost white |
| Sensitive |
Light Sensitive |
| BRN |
4343861 |
| InChI |
InChI=1S/C12H10I.F6P/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7(2,3,4,5)6/h1-10H;/q+1;-1 |
| InChIKey |
DSSRLRJACJENEU-UHFFFAOYSA-N |
| SMILES |
[I+](C1C=CC=CC=1)C1C=CC=CC=1.[P+5]([F-])([F-])([F-])([F-])([F-])[F-] |
| CAS DataBase Reference |
58109-40-3(CAS DataBase Reference) |
| EPA Substance Registry System |
Iodonium, diphenyl-, hexafluorophosphate(1-) (58109-40-3) |
