7,8-Dihydroxy-4-methylcoumarin
- Product Name7,8-Dihydroxy-4-methylcoumarin
- CAS2107-77-9
- MFC10H8O4
- MW192.17
- EINECS218-290-4
- MOL File2107-77-9.mol
Chemical Properties
| Melting point | 242-246 °C (lit.) |
| Boiling point | 421.5±45.0 °C(Predicted) |
| Density | 1.456±0.06 g/cm3(Predicted) |
| storage temp. | 2-8°C |
| solubility | Soluble in DMSO |
| pka | 7.72±0.20(Predicted) |
| form | powder to crystal |
| color | White to Light yellow to Light orange |
| Sensitive | Light Sensitive |
| λmax | 325nm(MeOH)(lit.) |
| BRN | 177613 |
| InChI | 1S/C10H8O4/c1-5-4-8(12)14-10-6(5)2-3-7(11)9(10)13/h2-4,11,13H,1H3 |
| InChIKey | NWQBYMPNIJXFNQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)Oc2c(O)c(O)ccc12 |
| CAS DataBase Reference | 2107-77-9(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36-43 |
| Safety Statements | 26-36/37 |
| WGK Germany | 3 |
| RTECS | GN6385000 |
| HS Code | 29349990 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Resp. Sens. 1 |