Tris(4-nitrophenyl) phosphate
- Product NameTris(4-nitrophenyl) phosphate
- CAS3871-20-3
- MFC18H12N3O10P
- MW461.28
- EINECS223-389-0
- MOL File3871-20-3.mol
Chemical Properties
| Melting point | 156-158 °C |
| Boiling point | 592.0±45.0 °C(Predicted) |
| Density | 1.572±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Chloroform |
| form | powder to crystal |
| color | White to Light red to Green |
| InChI | InChI=1S/C18H12N3O10P/c22-19(23)13-1-7-16(8-2-13)29-32(28,30-17-9-3-14(4-10-17)20(24)25)31-18-11-5-15(6-12-18)21(26)27/h1-12H |
| InChIKey | RZSPPBDBWOJRII-UHFFFAOYSA-N |
| SMILES | P(OC1=CC=C([N+]([O-])=O)C=C1)(OC1=CC=C([N+]([O-])=O)C=C1)(OC1=CC=C([N+]([O-])=O)C=C1)=O |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| RIDADR | UN 3082 9/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| HS Code | 29319090 |
