HEXABUTYLDITIN
- Product NameHEXABUTYLDITIN
- CAS813-19-4
- MFC24H54Sn2
- MW580.11
- EINECS212-383-3
- MOL File813-19-4.mol
Chemical Properties
| Boiling point | 197-198 °C (10 mmHg) |
| Density | 1.148 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 124°C |
| storage temp. | Inert atmosphere,2-8°C |
| solubility | Methanol (Slightly) |
| form | liquid |
| Specific Gravity | 1.148 |
| color | colorless to yellow |
| Water Solubility | Immiscible with water. |
| Sensitive | Air & Moisture Sensitive |
| BRN | 3605476 |
| Exposure limits | ACGIH: TWA 0.1 mg/m3; STEL 0.2 mg/m3 (Skin) NIOSH: IDLH 25 mg/m3; TWA 0.1 mg/m3 |
| InChI | InChI=1S/6C4H9.2Sn/c6*1-3-4-2;;/h6*1,3-4H2,2H3;; |
| InChIKey | REDSKZBUUUQMSK-UHFFFAOYSA-N |
| SMILES | [Sn](CCCC)(CCCC)(CCCC)[Sn](CCCC)(CCCC)CCCC |
| CAS DataBase Reference | 813-19-4(CAS DataBase Reference) |
Safety Information
| Hazard Codes | T,N |
| Risk Statements | 21-25-36/38-48/23/25-50/53 |
| Safety Statements | 35-36/37/39-45-60-61 |
| RIDADR | UN 2788 6.1/PG 1 |
| WGK Germany | 3 |
| F | 1-10 |
| TSCA | No |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29319019 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |
