Tributylstannyltrimethylsilane
- Product NameTributylstannyltrimethylsilane
- CAS17955-46-3
- MFC15H36SiSn
- MW363.24
- EINECS
- MOL File17955-46-3.mol
Chemical Properties
| Boiling point | 102-103 °C0.5 mm Hg(lit.) |
| Density | 1.04 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Store under Argon |
| solubility | soluble in THF, ether, CH2Cl2, MeOH, hexane, insoluble in water. |
| form | liquid |
| Specific Gravity | 1.040 |
| Appearance | Colorless to light yellow Liquid |
| Hydrolytic Sensitivity | 1: no significant reaction with aqueous systems |
| BRN | 4127163 |
| InChI | 1S/3C4H9.C3H9Si.Sn/c3*1-3-4-2;1-4(2)3;/h3*1,3-4H2,2H3;1-3H3; |
| InChIKey | MZUUBYSIDDKUKE-UHFFFAOYSA-N |
| SMILES | CCCC[Sn](CCCC)(CCCC)[Si](C)(C)C |
Safety Information
| Hazard Codes | T,N |
| Risk Statements | 21-25-36/38-48/23/25-50/53 |
| Safety Statements | 35-36/37/39-45-60-61 |
| RIDADR | UN 2788 6.1/PG 3 |
| WGK Germany | 3 |
| F | 10-21 |
| TSCA | No |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29319090 |
| Storage Class | 6.1C - Combustible acute toxic Cat.3 toxic compounds or compounds which causing chronic effects |
| Hazard Classifications | Acute Tox. 3 Oral Acute Tox. 4 Dermal Aquatic Acute 1 Aquatic Chronic 1 Eye Irrit. 2 Repr. 1B Skin Irrit. 2 STOT RE 1 |