1,3,3-Trimethylindolinonaphthospirooxazine
- Product Name1,3,3-Trimethylindolinonaphthospirooxazine
- CAS27333-47-7
- MFC22H20N2O
- MW328.41
- EINECS404-480-6
- MOL File27333-47-7.mol
Chemical Properties
| Melting point | 128-130 °C(lit.) |
| Boiling point | 529.1±50.0 °C(Predicted) |
| Density | 1.19 |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | soluble in Toluene,Benzene |
| form | powder to crystal |
| pka | 3.26±0.40(Predicted) |
| color | White to Orange to Green |
| InChI | InChI=1S/C22H20N2O/c1-21(2)17-10-6-7-11-18(17)24(3)22(21)14-23-20-16-9-5-4-8-15(16)12-13-19(20)25-22/h4-14H,1-3H3 |
| InChIKey | CQTRKDFIQFOAQV-UHFFFAOYSA-N |
| SMILES | N1(C)C2=C(C=CC=C2)C(C)(C)C21C=NC1=C3C(C=CC=C3)=CC=C1O2 |
| CAS DataBase Reference | 27333-47-7(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29349990 |
