Methyl 3-bromo-2-(bromomethyl)propionate
- Product NameMethyl 3-bromo-2-(bromomethyl)propionate
- CAS22262-60-8
- MFC5H8Br2O2
- MW259.92
- EINECS
- MOL File22262-60-8.mol
Chemical Properties
| Boiling point | 60-62 °C/0.4 mmHg (lit.) |
| Density | 1.82 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light red to Green |
| Specific Gravity | 1.82 |
| InChI | InChI=1S/C5H8Br2O2/c1-9-5(8)4(2-6)3-7/h4H,2-3H2,1H3 |
| InChIKey | USXVPPOARMSYGY-UHFFFAOYSA-N |
| SMILES | C(OC)(=O)C(CBr)CBr |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29159000 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |