1-Nitro-2-naphthol
- Product Name1-Nitro-2-naphthol
- CAS550-60-7
- MFC10H7NO3
- MW189.17
- EINECS208-984-5
- MOL File550-60-7.mol
Chemical Properties
| Melting point | 103°C |
| Boiling point | 324.41°C (rough estimate) |
| Density | 1.413 |
| refractive index | 1.5400 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| form | powder to crystal |
| pka | 6.30±0.50(Predicted) |
| color | White to Yellow to Orange |
| Water Solubility | 0.2g/L(20 ºC) |
| Merck | 14,6614 |
| InChI | InChI=1S/C10H7NO3/c12-9-6-5-7-3-1-2-4-8(7)10(9)11(13)14/h1-6,12H |
| InChIKey | SSHIVHKMGVBXTJ-UHFFFAOYSA-N |
| SMILES | C1([N+]([O-])=O)=C2C(C=CC=C2)=CC=C1O |
Safety Information
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36/37/39 |
| RTECS | QL4500000 |
| HS Code | 2906290090 |
