1-Boc-hexahydro-1,4-diazepine
- Product Name1-Boc-hexahydro-1,4-diazepine
- CAS112275-50-0
- MFC10H20N2O2
- MW200.28
- EINECS628-955-4
- MOL File112275-50-0.mol
Chemical Properties
| Melting point | 143.4 °C |
| Boiling point | 95-110 °C0.5 mm Hg(lit.) |
| Density | 1.016 g/mL at 20 °C(lit.) |
| refractive index | n |
| Flash point | >230 °F |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| pka | 10.45±0.20(Predicted) |
| form | Liquid |
| Specific Gravity | 1.016 |
| color | Colorless to yellow |
| Water Solubility | Not miscible or difficult to mix in water. |
| Sensitive | Air Sensitive |
| BRN | 7581789 |
| InChI | InChI=1S/C10H20N2O2/c1-10(2,3)14-9(13)12-7-4-5-11-6-8-12/h11H,4-8H2,1-3H3 |
| InChIKey | WDPWEXWMQDRXAL-UHFFFAOYSA-N |
| SMILES | N1(C(OC(C)(C)C)=O)CCCNCC1 |
| CAS DataBase Reference | 112275-50-0(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | 2735 |
| WGK Germany | 3 |
| F | 10-34 |
| Hazard Note | Irritant |
| HazardClass | IRRITANT, KEEP COLD |
| HazardClass | 8 |
| HS Code | 29339900 |
| Storage Class | 10 - Combustible liquids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
