3,5-Dimethylbenzaldehyde
- Product Name3,5-Dimethylbenzaldehyde
- CAS5779-95-3
- MFC9H10O
- MW134.18
- EINECS
- MOL File5779-95-3.mol
Chemical Properties
| Melting point | 8-10 °C |
| Boiling point | 232 °C (lit.) |
| Density | 0.998 g/mL at 25 °C (lit.) |
| refractive index | n |
| Flash point | 210 °F |
| storage temp. | Inert atmosphere,2-8°C |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Water Solubility | Not miscible with water. |
| Sensitive | Air Sensitive |
| BRN | 2038840 |
| Henry's Law Constant | 1.2×100 mol/(m3Pa) at 25℃, Wang et al. (2017) |
| InChI | InChI=1S/C9H10O/c1-7-3-8(2)5-9(4-7)6-10/h3-6H,1-2H3 |
| InChIKey | NBEFMISJJNGCIZ-UHFFFAOYSA-N |
| SMILES | C(=O)C1=CC(C)=CC(C)=C1 |
| LogP | 2.560 (est) |
| CAS DataBase Reference | 5779-95-3(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzaldehyde, 3,5-dimethyl-(5779-95-3) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 24/25 |
| WGK Germany | 3 |
| HS Code | 29122990 |
| Storage Class | 10 - Combustible liquids |
