1-Chloro-4-fluorobenzene
- Product Name1-Chloro-4-fluorobenzene
- CAS352-33-0
- MFC6H4ClF
- MW130.55
- EINECS206-521-1
- MOL File352-33-0.mol
Chemical Properties
| Melting point | -26 °C |
| Boiling point | 130 °C |
| Density | 1.23 |
| refractive index | 1.50 |
| Flash point | 29 °C |
| storage temp. | Flammables area |
| solubility | Difficult to mix. |
| form | clear liquid |
| color | Colorless to Light yellow |
| Specific Gravity | 1.226 |
| BRN | 1904542 |
| InChI | InChI=1S/C6H4ClF/c7-5-1-3-6(8)4-2-5/h1-4H |
| InChIKey | RJCGZNCCVKIBHO-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(F)C=C1 |
| CAS DataBase Reference | 352-33-0(CAS DataBase Reference) |
| NIST Chemistry Reference | Benzene, 1-chloro-4-fluoro-(352-33-0) |
| EPA Substance Registry System | Benzene, 1-chloro-4-fluoro- (352-33-0) |
Safety Information
| Hazard Codes | Xi,F,T |
| Risk Statements | 10-36/37/38-39/23/24/25-23/24/25-11 |
| Safety Statements | 16-26-36-37/39-45-36/37-7 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| Hazard Note | Flammable/Irritant |
| TSCA | TSCA listed |
| HazardClass | 3 |
| PackingGroup | III |
| HS Code | 29039990 |
| Storage Class | 3 - Flammable liquids |
| Hazard Classifications | Eye Irrit. 2 Flam. Liq. 3 Skin Irrit. 2 STOT SE 3 |
