1,2-Dichloro-4-fluorobenzene
- Product Name1,2-Dichloro-4-fluorobenzene
- CAS1435-49-0
- MFC6H3Cl2F
- MW164.99
- EINECS215-858-3
- MOL File1435-49-0.mol
Chemical Properties
| Melting point | −1 °C(lit.) |
| Boiling point | 172 °C(lit.) |
| Density | 1.403 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point | 148 °F |
| storage temp. | Sealed in dry,Room Temperature |
| form | clear liquid |
| color | Colorless to Light yellow to Light orange |
| Specific Gravity | 1.403 |
| BRN | 1861278 |
| InChI | InChI=1S/C6H3Cl2F/c7-5-2-1-4(9)3-6(5)8/h1-3H |
| InChIKey | QSDKXMVGRLVIQV-UHFFFAOYSA-N |
| SMILES | C1(Cl)=CC=C(F)C=C1Cl |
| CAS DataBase Reference | 1435-49-0(CAS DataBase Reference) |
| NIST Chemistry Reference | 1,2-Dichloro-4-fluorobenzene(1435-49-0) |
Safety Information
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-37/39-37 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| PackingGroup | III |
| HS Code | 29039990 |
