Diphenylamine-4-sulfonic acid barium salt
- Product NameDiphenylamine-4-sulfonic acid barium salt
- CAS6211-24-1
- MFC12H13BaNO3S
- MW388.63
- EINECS228-278-0
- MOL File6211-24-1.mol
Chemical Properties
| Melting point | >300°C |
| bulk density | 220kg/m3 |
| storage temp. | Store at +5°C to +30°C. |
| solubility | Acetonitrile (Slightly), DMSO (Slightly, Heated) |
| form | Powder |
| color | White |
| Odor | Odorless |
| PH | 5.9 (10g/l, H2O, 20℃)(slurry) |
| Water Solubility | It is moderate soluble in water. |
| λmax | 290-295 nm in water |
| Merck | 14,7313 |
| BRN | 3795146 |
| Exposure limits | ACGIH: TWA 0.5 mg/m3 NIOSH: IDLH 50 mg/m3; TWA 0.5 mg/m3 |
| Stability | Stable. Incompatible with mineral acids, organic acids, strong oxidizing agents. |
| InChI | 1S/2C12H11NO3S.Ba/c2*14-17(15,16)12-8-6-11(7-9-12)13-10-4-2-1-3-5-10;/h2*1-9,13H,(H,14,15,16);/q;;+2/p-2 |
| InChIKey | IVCNVXFNTKXMCA-UHFFFAOYSA-L |
| SMILES | [Ba+2].[S](=O)(=O)([O-])c3ccc(cc3)Nc4ccccc4.[S](=O)(=O)([O-])c1ccc(cc1)Nc2ccccc2 |
| CAS DataBase Reference | 6211-24-1(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xn |
| Risk Statements | 20/22 |
| Safety Statements | 28 |
| RIDADR | 1564 |
| WGK Germany | 1 |
| TSCA | TSCA listed |
| HS Code | 2921 44 00 |
| HazardClass | 6.1 |
| PackingGroup | III |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Acute Tox. 4 Inhalation Acute Tox. 4 Oral |
