1-Methyl-5-nitro-1H-imidazole-2-methanol
- Product Name1-Methyl-5-nitro-1H-imidazole-2-methanol
- CAS936-05-0
- MFC5H7N3O3
- MW157.13
- EINECS213-312-9
- MOL File936-05-0.mol
Chemical Properties
| Melting point | 110-112°C |
| Boiling point | 281.76°C (rough estimate) |
| Density | 1.4890 (rough estimate) |
| refractive index | 1.6190 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMF: 30 mg/ml; DMSO: 30 mg/ml; Ethanol: 3 mg/ml; PBS (pH 7.2): 1 mg/ml |
| form | Solid |
| pka | 13.31±0.10(Predicted) |
| color | Light yellow to Yellow to Orange |
| Major Application | forensics and toxicology pharmaceutical (small molecule) |
| InChI | InChI=1S/C5H7N3O3/c1-7-4(3-9)6-2-5(7)8(10)11/h2,9H,3H2,1H3 |
| InChIKey | JSAQDPJIVQMBAY-UHFFFAOYSA-N |
| SMILES | C1(CO)N(C)C([N+]([O-])=O)=CN=1 |
Safety Information
| WGK Germany | 3 |
| RTECS | NI6801000 |
| HS Code | 29332900 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Carc. 2 Muta. 2 |