5-Bromo-2-hydroxyacetophenone
- Product Name5-Bromo-2-hydroxyacetophenone
- CAS1450-75-5
- MFC8H7BrO2
- MW215.04
- EINECS604-457-2
- MOL File1450-75-5.mol
Chemical Properties
| Melting point | 58-61 °C(lit.) |
| Boiling point | 135-143 °C(Press: 16 Torr) |
| Density | 1.586±0.06 g/cm3(Predicted) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Soluble in Chloroform |
| pka | 9.59±0.18(Predicted) |
| form | Solid |
| color | White to pale yellow |
| InChI | InChI=1S/C8H7BrO2/c1-5(10)7-4-6(9)2-3-8(7)11/h2-4,11H,1H3 |
| InChIKey | HQCCNFFIOWYINW-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(Br)=CC=C1O)C |
| LogP | 3.110 (est) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | KM5556350 |
| HazardClass | IRRITANT |
| HS Code | 29147000 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
| Toxicity | mouse,LD50,intraperitoneal,> 1gm/kg (1000mg/kg),Indian Journal of Chemistry, Section B: Organic Chemistry, Including Medicinal Chemistry. Vol. 20, Pg. 480, 1981. |
