6-Bromo-3-formylchromone
- Product Name6-Bromo-3-formylchromone
- CAS52817-12-6
- MFC10H5BrO3
- MW253.05
- EINECS123-562-6
- MOL File52817-12-6.mol
Chemical Properties
| Melting point | 190-193 °C(lit.) |
| Boiling point | 365.7±42.0 °C(Predicted) |
| Density | 1.835±0.06 g/cm3(Predicted) |
| storage temp. | Inert atmosphere,Room Temperature |
| form | powder to crystal |
| color | White to Yellow to Orange |
| InChI | 1S/C10H5BrO3/c11-7-1-2-9-8(3-7)10(13)6(4-12)5-14-9/h1-5H |
| InChIKey | PCEZXSJBHMOQFT-UHFFFAOYSA-N |
| SMILES | [H]C(=O)C1=COc2ccc(Br)cc2C1=O |
| CAS DataBase Reference | 52817-12-6(CAS DataBase Reference) |
Safety Information
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 2932990090 |
| Storage Class | 11 - Combustible Solids |
| Hazard Classifications | Eye Irrit. 2 Skin Irrit. 2 STOT SE 3 |
