Carbofuran-3-hydroxy
- Product NameCarbofuran-3-hydroxy
- CAS16655-82-6
- MFC12H15NO4
- MW237.25
- EINECS
- MOL File16655-82-6.mol
Chemical Properties
| Melting point | 140-148 °C |
| Boiling point | 344.7±42.0 °C(Predicted) |
| Density | 1.239±0.06 g/cm3 (20 ºC 760 Torr) |
| Flash point | -4 °C |
| storage temp. | -20°C |
| solubility | Chloroform: Soluble; Methanol: Soluble |
| pka | 12.28±0.46(Predicted) |
| BRN | 1383873 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C12H15NO4/c1-12(2)10(14)7-5-4-6-8(9(7)17-12)16-11(15)13-3/h4-6,10,14H,1-3H3,(H,13,15) |
| InChIKey | RHSUJRQZTQNSLL-UHFFFAOYSA-N |
| SMILES | O1C2=C(OC(=O)NC)C=CC=C2C(O)C1(C)C |
| EPA Substance Registry System | 3-Hydroxycarbofuran (16655-82-6) |
Safety Information
| Hazard Codes | T+,Xi,F |
| Risk Statements | 28-67-66-36-11 |
| Safety Statements | 28-36/37/39-45-33-26-16 |
| RIDADR | 2757 |
| WGK Germany | 3 |
| RTECS | FB9500000 |
| HazardClass | 6.1(a) |
| PackingGroup | II |
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials |
| Hazard Classifications | Acute Tox. 2 Oral |
| Toxicity | mouse,LD50,oral,7mg/kg (7mg/kg),Pesticide Biochemistry and Physiology. Vol. 3, Pg. 435, 1973. |