Carbofuran-3-hydroxy
- Product NameCarbofuran-3-hydroxy
- CAS16655-82-6
- CBNumberCB7763485
- MFC12H15NO4
- MW237.25
- MDL NumberMFCD00143168
- MOL File16655-82-6.mol
- MSDS FileSDS
Chemical Properties
| Melting point | 140-148 °C |
| Boiling point | 344.7±42.0 °C(Predicted) |
| Density | 1.239±0.06 g/cm3 (20 ºC 760 Torr) |
| Flash point | -4 °C |
| storage temp. | -20°C |
| solubility | Chloroform: Soluble; Methanol: Soluble |
| pka | 12.28±0.46(Predicted) |
| BRN | 1383873 |
| Major Application | agriculture environmental |
| InChI | InChI=1S/C12H15NO4/c1-12(2)10(14)7-5-4-6-8(9(7)17-12)16-11(15)13-3/h4-6,10,14H,1-3H3,(H,13,15) |
| InChIKey | RHSUJRQZTQNSLL-UHFFFAOYSA-N |
| SMILES | O1C2=C(OC(=O)NC)C=CC=C2C(O)C1(C)C |
| EWG's Food Scores | 1 |
| FDA UNII | 7J7N7A61BJ |
| EPA Substance Registry System | 3-Hydroxycarbofuran (16655-82-6) |
| UNSPSC Code | 41116107 |
| NACRES | NA.24 |
Safety
| Symbol(GHS) |
|
|||||||||
| Signal word | Danger | |||||||||
| Hazard statements | H300 | |||||||||
| Precautionary statements | P264-P270-P301+P310-P405-P501 | |||||||||
| Hazard Codes | T+,Xi,F | |||||||||
| Risk Statements | 28-67-66-36-11 | |||||||||
| Safety Statements | 28-36/37/39-45-33-26-16 | |||||||||
| RIDADR | 2757 | |||||||||
| WGK Germany | 3 | |||||||||
| RTECS | FB9500000 | |||||||||
| HazardClass | 6.1(a) | |||||||||
| PackingGroup | II | |||||||||
| Storage Class | 6.1A - Combustible acute toxic Cat. 1 and 2 very toxic hazardous materials | |||||||||
| Hazard Classifications | Acute Tox. 2 Oral | |||||||||
| Toxicity | mouse,LD50,oral,7mg/kg (7mg/kg),Pesticide Biochemistry and Physiology. Vol. 3, Pg. 435, 1973. | |||||||||
| NFPA 704: |
|
