| Melting point |
80-83°C |
| Boiling point |
171 °C / 4mmHg |
| Density |
1.089±0.06 g/cm3(Predicted) |
| vapor pressure |
0.014Pa at 25℃ |
| storage temp. |
Keep in dark place,Sealed in dry,Room Temperature |
| solubility |
almost transparency in Toluene |
| form |
powder to crystal |
| pka |
1.35±0.40(Predicted) |
| color |
White to Brown |
| Water Solubility |
16.79mg/L at 25℃ |
| InChI |
InChI=1S/C14H15NO/c1-11-10-13(16-2)8-9-14(11)15-12-6-4-3-5-7-12/h3-10,15H,1-2H3 |
| InChIKey |
CYMPUOGZUXAIMY-UHFFFAOYSA-N |
| SMILES |
C1(NC2=CC=CC=C2)=CC=C(OC)C=C1C |
| LogP |
3.92 at 25℃ |
| CAS DataBase Reference |
41317-15-1(CAS DataBase Reference) |
| EPA Substance Registry System |
4-Methoxy-2-methyldiphenylamine (41317-15-1) |
