| Melting point |
298° |
| alpha |
D20 -47° (pyridine); D20 -32° (10% aq pyridine) |
| Boiling point |
466.08°C (rough estimate) |
| Density |
1.3597 (rough estimate) |
| refractive index |
1.5376 (estimate) |
| storage temp. |
under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility |
Aqueous Base (Slightly), DMSO (Slightly, Heated), Pyridine (Slightly, Sonicated) |
| pka |
6.45±0.20(Predicted) |
| form |
Solid |
| color |
White to Light Brown |
| λmax |
271nm(MeOH)(lit.) |
| Major Application |
metabolomics vitamins, nutraceuticals, and natural products |
| InChIKey |
ISQRJFLLIDGZEP-JNAFRSBINA-N |
| SMILES |
C12C(O)=CC(O)=CC=1OC=C(C1C=CC(O[C@H]3[C@H](O)[C@H]([C@H](O)[C@@H](CO)O3)O)=CC=1)C2=O |&1:16,17,19,20,22,r| |
| CAS DataBase Reference |
152-95-4(CAS DataBase Reference) |